C11H15NO5S — CID 70115907
N-(2-acetyl-4,5-dimethoxyphenyl)methanesulfonamide (PubChem CID 70115907) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is N-(2-acetyl-4,5-dimethoxyphenyl)methanesulfonamide.
| Compound Name | N-(2-acetyl-4,5-dimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 70115907 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-(2-acetyl-4,5-dimethoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(NS(C)(=O)=O)c(C(C)=O)cc1OC |
| InChI | InChI=1S/C11H15NO5S/c1-7(13)8-5-10(16-2)11(17-3)6-9(8)12-18(4,14)15/h5-6,12H,1-4H3 |
| InChIKey | DXYIZENHTJSCOI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |