About 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride
5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride (PubChem CID 161291198) has the molecular formula C11H17Cl3NO5PS
and a molecular weight of 412.66 g/mol. Its IUPAC name is 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride.
Molecular Properties
| Compound Name | 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride |
| PubChem CID | 161291198 |
| Molecular Formula | C11H17Cl3NO5PS |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride |
| SMILES | C.CC(=O)Nc1cc(S(=O)(=O)O)c(C)cc1C.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H13NO4S.CH4.Cl3OP/c1-6-4-7(2)10(16(13,14)15)5-9(6)11-8(3)12;;1-5(2,3)4/h4-5H,1-3H3,(H,11,12)(H,13,14,15);1H4; |
| InChIKey | VGJDCVXOZMBWCG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride?
The IUPAC name of 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride (CID 161291198) is 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride.
What is the SMILES notation for 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride?
The canonical SMILES for 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride is C.CC(=O)Nc1cc(S(=O)(=O)O)c(C)cc1C.O=P(Cl)(Cl)Cl.
What is the InChIKey of 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride?
The InChIKey is VGJDCVXOZMBWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S.CH4.Cl3OP/c1-6-4-7(2)10(16(13,14)15)5-9(6)11-8(3)12;;1-5(2,3)4/h4-5H,1-3H3,(H,11,12)(H,13,14,15);1H4;.
What are the key properties of 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride?
5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride has a molecular weight of 412.66 g/mol, XLogP of 4.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetamido-2,4-dimethylbenzenesulfonic acid;methane;phosphoryl trichloride is sourced from PubChem (CID 161291198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).