C18H15NO9S2 — CID 102601252
2-hydroxy-5-[(5-hydroxy-7-sulfonaphthalen-2-yl)-methylsulfamoyl]benzoic acid (PubChem CID 102601252) has the molecular formula C18H15NO9S2 and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-hydroxy-5-[(5-hydroxy-7-sulfonaphthalen-2-yl)-methylsulfamoyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[(5-hydroxy-7-sulfonaphthalen-2-yl)-methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 102601252 |
| Molecular Formula | C18H15NO9S2 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 2-hydroxy-5-[(5-hydroxy-7-sulfonaphthalen-2-yl)-methylsulfamoyl]benzoic acid |
| SMILES | CN(c1ccc2c(O)cc(S(=O)(=O)O)cc2c1)S(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H15NO9S2/c1-19(29(24,25)12-3-5-16(20)15(8-12)18(22)23)11-2-4-14-10(6-11)7-13(9-17(14)21)30(26,27)28/h2-9,20-21H,1H3,(H,22,23)(H,26,27,28) |
| InChIKey | LDEFDCQNMXVZGK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 169.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|