C11H19N3O7S — CID 157150038
guanidine;2-hydroxy-5-sulfobenzoic acid;propan-2-ol (PubChem CID 157150038) has the molecular formula C11H19N3O7S and a molecular weight of 337.35 g/mol. Its IUPAC name is guanidine;2-hydroxy-5-sulfobenzoic acid;propan-2-ol.
| Compound Name | guanidine;2-hydroxy-5-sulfobenzoic acid;propan-2-ol |
|---|---|
| PubChem CID | 157150038 |
| Molecular Formula | C11H19N3O7S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | guanidine;2-hydroxy-5-sulfobenzoic acid;propan-2-ol |
| SMILES | CC(C)O.O=C(O)c1cc(S(=O)(=O)O)ccc1O.[H]N=C(N)N |
| InChI | InChI=1S/C7H6O6S.C3H8O.CH5N3/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;1-3(2)4;2-1(3)4/h1-3,8H,(H,9,10)(H,11,12,13);3-4H,1-2H3;(H5,2,3,4) |
| InChIKey | ALDNVBJJCPGQDP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 208.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|