C28H20N6O9S2 — CID 135854012
7-[[2,6-dihydroxy-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 135854012) has the molecular formula C28H20N6O9S2 and a molecular weight of 648.64 g/mol. Its IUPAC name is 7-[[2,6-dihydroxy-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[[2,6-dihydroxy-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135854012 |
| Molecular Formula | C28H20N6O9S2 |
| Molecular Weight | 648.64 g/mol |
| Exact Mass | 648.07 |
| IUPAC Name | 7-[[2,6-dihydroxy-3-[[4-[(4-sulfophenyl)diazenyl]phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=N/c2ccc(/N=N/c3ccc(O)c(/N=N/c4ccc5c(O)cc(S(=O)(=O)O)cc5c4)c3O)cc2)cc1 |
| InChI | InChI=1S/C28H20N6O9S2/c35-25-12-11-24(33-31-18-3-1-17(2-4-18)29-30-19-5-8-21(9-6-19)44(38,39)40)28(37)27(25)34-32-20-7-10-23-16(13-20)14-22(15-26(23)36)45(41,42)43/h1-15,35-37H,(H,38,39,40)(H,41,42,43)/b30-29+,33-31+,34-32+ |
| InChIKey | OEWOOSQRLFYONT-FSVBEFDCSA-N |
| XLogP | 7.70 |
| TPSA | 243.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|