C18H11NO4 — CID 169334915
5-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]furan-2-carbaldehyde (PubChem CID 169334915) has the molecular formula C18H11NO4 and a molecular weight of 305.29 g/mol. Its IUPAC name is 5-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334915 |
| Molecular Formula | C18H11NO4 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(O)c(-c3nc4ccccc4o3)c2)o1 |
| InChI | InChI=1S/C18H11NO4/c20-10-12-6-8-16(22-12)11-5-7-15(21)13(9-11)18-19-14-3-1-2-4-17(14)23-18/h1-10,21H |
| InChIKey | OSXMRPZGVVBWLY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|