C35H24LiN3O2 — CID 175568639
lithium;2-(1,3-benzoxazol-2-yl)-4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenol;hydride (PubChem CID 175568639) has the molecular formula C35H24LiN3O2 and a molecular weight of 525.54 g/mol. Its IUPAC name is lithium;2-(1,3-benzoxazol-2-yl)-4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenol;hydride.
| Compound Name | lithium;2-(1,3-benzoxazol-2-yl)-4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenol;hydride |
|---|---|
| PubChem CID | 175568639 |
| Molecular Formula | C35H24LiN3O2 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | lithium;2-(1,3-benzoxazol-2-yl)-4-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]phenol;hydride |
| SMILES | Oc1ccc(-c2cccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c2)cc1-c1nc2ccccc2o1.[H-].[Li+] |
| InChI | InChI=1S/C35H23N3O2.Li.H/c39-32-19-18-26(21-28(32)35-38-29-16-7-8-17-33(29)40-35)25-14-9-15-27(20-25)34-36-30(23-10-3-1-4-11-23)22-31(37-34)24-12-5-2-6-13-24;;/h1-22,39H;;/q;+1;-1 |
| InChIKey | ROHPYNFJPBKBPJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |