C41H25N3O2 — CID 147695392
2-[9-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]dibenzofuran-3-yl]-1,3-benzoxazole (PubChem CID 147695392) has the molecular formula C41H25N3O2 and a molecular weight of 591.67 g/mol. Its IUPAC name is 2-[9-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]dibenzofuran-3-yl]-1,3-benzoxazole.
| Compound Name | 2-[9-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]dibenzofuran-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 147695392 |
| Molecular Formula | C41H25N3O2 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 2-[9-[2-phenyl-6-(3-phenylphenyl)pyrimidin-4-yl]dibenzofuran-3-yl]-1,3-benzoxazole |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4cccc5oc6cc(-c7nc8ccccc8o7)ccc6c45)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C41H25N3O2/c1-3-11-26(12-4-1)28-15-9-16-29(23-28)34-25-35(43-40(42-34)27-13-5-2-6-14-27)31-17-10-20-37-39(31)32-22-21-30(24-38(32)45-37)41-44-33-18-7-8-19-36(33)46-41/h1-25H |
| InChIKey | GRUJZLSMDGDQGU-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |