C20H16N2O3 — CID 169334400
5-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carbaldehyde (PubChem CID 169334400) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carbaldehyde.
| Compound Name | 5-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334400 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-[2-[4-(dimethylamino)phenyl]-1,3-benzoxazol-5-yl]furan-2-carbaldehyde |
| SMILES | CN(C)c1ccc(-c2nc3cc(-c4ccc(C=O)o4)ccc3o2)cc1 |
| InChI | InChI=1S/C20H16N2O3/c1-22(2)15-6-3-13(4-7-15)20-21-17-11-14(5-9-19(17)25-20)18-10-8-16(12-23)24-18/h3-12H,1-2H3 |
| InChIKey | KZKGTNXAPJVLDB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|