C18H9N5O4S — CID 168610196
3-(1,3-benzoxazol-2-yl)-4-(1,2,2-tricyanoethenylamino)benzenesulfonic acid (PubChem CID 168610196) has the molecular formula C18H9N5O4S and a molecular weight of 391.37 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-4-(1,2,2-tricyanoethenylamino)benzenesulfonic acid.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-4-(1,2,2-tricyanoethenylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 168610196 |
| Molecular Formula | C18H9N5O4S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-4-(1,2,2-tricyanoethenylamino)benzenesulfonic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(S(=O)(=O)O)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H9N5O4S/c19-8-11(9-20)16(10-21)22-14-6-5-12(28(24,25)26)7-13(14)18-23-15-3-1-2-4-17(15)27-18/h1-7,22H,(H,24,25,26) |
| InChIKey | PANKHDJOYOBCDJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 163.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|