C16H8Cl2N5NaO4S — CID 142760788
sodium 3-(1,3-benzoxazol-2-yl)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate (PubChem CID 142760788) has the molecular formula C16H8Cl2N5NaO4S and a molecular weight of 460.23 g/mol. Its IUPAC name is sodium 3-(1,3-benzoxazol-2-yl)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate.
| Compound Name | sodium 3-(1,3-benzoxazol-2-yl)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 142760788 |
| Molecular Formula | C16H8Cl2N5NaO4S |
| Molecular Weight | 460.23 g/mol |
| Exact Mass | 458.96 |
| IUPAC Name | sodium 3-(1,3-benzoxazol-2-yl)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(Nc2nc(Cl)nc(Cl)n2)c(-c2nc3ccccc3o2)c1.[Na+] |
| InChI | InChI=1S/C16H9Cl2N5O4S.Na/c17-14-21-15(18)23-16(22-14)20-10-6-5-8(28(24,25)26)7-9(10)13-19-11-3-1-2-4-12(11)27-13;/h1-7H,(H,24,25,26)(H,20,21,22,23);/q;+1/p-1 |
| InChIKey | VQBIKLRAMMWRSU-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|