C17H11ClN4O — CID 3316480
5-(1,3-benzoxazol-2-yl)-N-(2-chlorophenyl)pyrimidin-2-amine (PubChem CID 3316480) has the molecular formula C17H11ClN4O and a molecular weight of 322.76 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-yl)-N-(2-chlorophenyl)pyrimidin-2-amine.
| Compound Name | 5-(1,3-benzoxazol-2-yl)-N-(2-chlorophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 3316480 |
| Molecular Formula | C17H11ClN4O |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-(1,3-benzoxazol-2-yl)-N-(2-chlorophenyl)pyrimidin-2-amine |
| SMILES | Clc1ccccc1Nc1ncc(-c2nc3ccccc3o2)cn1 |
| InChI | InChI=1S/C17H11ClN4O/c18-12-5-1-2-6-13(12)22-17-19-9-11(10-20-17)16-21-14-7-3-4-8-15(14)23-16/h1-10H,(H,19,20,22) |
| InChIKey | DXSQRIPVHSCQTO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |