C18H14N4O2 — CID 59203844
5-(6-methoxy-1,3-benzoxazol-2-yl)-N-phenylpyrimidin-2-amine (PubChem CID 59203844) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-(6-methoxy-1,3-benzoxazol-2-yl)-N-phenylpyrimidin-2-amine.
| Compound Name | 5-(6-methoxy-1,3-benzoxazol-2-yl)-N-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 59203844 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-(6-methoxy-1,3-benzoxazol-2-yl)-N-phenylpyrimidin-2-amine |
| SMILES | COc1ccc2nc(-c3cnc(Nc4ccccc4)nc3)oc2c1 |
| InChI | InChI=1S/C18H14N4O2/c1-23-14-7-8-15-16(9-14)24-17(22-15)12-10-19-18(20-11-12)21-13-5-3-2-4-6-13/h2-11H,1H3,(H,19,20,21) |
| InChIKey | DECLYJIGPYNKTH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |