C15H10N2O2 — CID 118902982
2-(6-methoxy-1,3-benzoxazol-2-yl)benzonitrile (PubChem CID 118902982) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(6-methoxy-1,3-benzoxazol-2-yl)benzonitrile.
| Compound Name | 2-(6-methoxy-1,3-benzoxazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 118902982 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(6-methoxy-1,3-benzoxazol-2-yl)benzonitrile |
| SMILES | COc1ccc2nc(-c3ccccc3C#N)oc2c1 |
| InChI | InChI=1S/C15H10N2O2/c1-18-11-6-7-13-14(8-11)19-15(17-13)12-5-3-2-4-10(12)9-16/h2-8H,1H3 |
| InChIKey | XIHHXXIPBVQUSO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |