C33H23NO4 — CID 68982927
2-[4-[4-[2-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenoxy]-2-phenylacetic acid (PubChem CID 68982927) has the molecular formula C33H23NO4 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-[4-[4-[2-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenoxy]-2-phenylacetic acid.
| Compound Name | 2-[4-[4-[2-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenoxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 68982927 |
| Molecular Formula | C33H23NO4 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[4-[4-[2-(1,3-benzoxazol-2-yl)phenyl]phenyl]phenoxy]-2-phenylacetic acid |
| SMILES | O=C(O)C(Oc1ccc(-c2ccc(-c3ccccc3-c3nc4ccccc4o3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H23NO4/c35-33(36)31(25-8-2-1-3-9-25)37-26-20-18-23(19-21-26)22-14-16-24(17-15-22)27-10-4-5-11-28(27)32-34-29-12-6-7-13-30(29)38-32/h1-21,31H,(H,35,36) |
| InChIKey | WHASZUKPNPIWMA-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |