C16H14N2O4S — CID 110656615
2-(benzenesulfonylmethyl)-5-(phenoxymethyl)-1,3,4-oxadiazole (PubChem CID 110656615) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-5-(phenoxymethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(benzenesulfonylmethyl)-5-(phenoxymethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 110656615 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-5-(phenoxymethyl)-1,3,4-oxadiazole |
| SMILES | O=S(=O)(Cc1nnc(COc2ccccc2)o1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O4S/c19-23(20,14-9-5-2-6-10-14)12-16-18-17-15(22-16)11-21-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | AMDXGFVBWFOWBT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |