C23H19N3O3 — CID 15954166
N-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]methoxy]-1,1-diphenylmethanimine (PubChem CID 15954166) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]methoxy]-1,1-diphenylmethanimine.
| Compound Name | N-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]methoxy]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 15954166 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]methoxy]-1,1-diphenylmethanimine |
| SMILES | c1ccc(OCc2nnc(CON=C(c3ccccc3)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H19N3O3/c1-4-10-18(11-5-1)23(19-12-6-2-7-13-19)26-28-17-22-25-24-21(29-22)16-27-20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | GAWLHSZISLTICC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|