C15H16N2OS — CID 174355378
2-(4-pentyl-1,3-thiazol-2-yl)-1,3-benzoxazole (PubChem CID 174355378) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-(4-pentyl-1,3-thiazol-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(4-pentyl-1,3-thiazol-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 174355378 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(4-pentyl-1,3-thiazol-2-yl)-1,3-benzoxazole |
| SMILES | CCCCCc1csc(-c2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C15H16N2OS/c1-2-3-4-7-11-10-19-15(16-11)14-17-12-8-5-6-9-13(12)18-14/h5-6,8-10H,2-4,7H2,1H3 |
| InChIKey | FARKFJJQCIUUFJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|