C12H11N3OS — CID 66372909
2-[4-(1,3-benzoxazol-2-yl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 66372909) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 66372909 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | NCCc1nc(-c2nc3ccccc3o2)cs1 |
| InChI | InChI=1S/C12H11N3OS/c13-6-5-11-14-9(7-17-11)12-15-8-3-1-2-4-10(8)16-12/h1-4,7H,5-6,13H2 |
| InChIKey | TURBQOWCRAAVRL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |