C17H18N2O — CID 159857474
5-(1,3-benzoxazol-2-yl)-2-butylaniline (PubChem CID 159857474) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-yl)-2-butylaniline.
| Compound Name | 5-(1,3-benzoxazol-2-yl)-2-butylaniline |
|---|---|
| PubChem CID | 159857474 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5-(1,3-benzoxazol-2-yl)-2-butylaniline |
| SMILES | CCCCc1ccc(-c2nc3ccccc3o2)cc1N |
| InChI | InChI=1S/C17H18N2O/c1-2-3-6-12-9-10-13(11-14(12)18)17-19-15-7-4-5-8-16(15)20-17/h4-5,7-11H,2-3,6,18H2,1H3 |
| InChIKey | GALUJNOAJOWLOE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|