C9H12ClN3O3S2 — CID 135506578
2-[(6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-ylidene)amino]-2-methylpropan-1-ol (PubChem CID 135506578) has the molecular formula C9H12ClN3O3S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-[(6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-ylidene)amino]-2-methylpropan-1-ol.
| Compound Name | 2-[(6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-ylidene)amino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 135506578 |
| Molecular Formula | C9H12ClN3O3S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-[(6-chloro-1,1-dioxo-4H-thieno[3,2-e][1,2,4]thiadiazin-3-ylidene)amino]-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)/N=C1\Nc2cc(Cl)sc2S(=O)(=O)N1 |
| InChI | InChI=1S/C9H12ClN3O3S2/c1-9(2,4-14)12-8-11-5-3-6(10)17-7(5)18(15,16)13-8/h3,14H,4H2,1-2H3,(H2,11,12,13) |
| InChIKey | DHRBLTDMDGLESQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|