C5H3ClN2OS2 — CID 57020535
6-chloro-4H-thieno[3,2-e][1,2,4]thiadiazin-3-one (PubChem CID 57020535) has the molecular formula C5H3ClN2OS2 and a molecular weight of 206.68 g/mol. Its IUPAC name is 6-chloro-4H-thieno[3,2-e][1,2,4]thiadiazin-3-one.
| Compound Name | 6-chloro-4H-thieno[3,2-e][1,2,4]thiadiazin-3-one |
|---|---|
| PubChem CID | 57020535 |
| Molecular Formula | C5H3ClN2OS2 |
| Molecular Weight | 206.68 g/mol |
| Exact Mass | 205.94 |
| IUPAC Name | 6-chloro-4H-thieno[3,2-e][1,2,4]thiadiazin-3-one |
| SMILES | O=C1NSc2sc(Cl)cc2N1 |
| InChI | InChI=1S/C5H3ClN2OS2/c6-3-1-2-4(10-3)11-8-5(9)7-2/h1H,(H2,7,8,9) |
| InChIKey | FEMNDXCFWLGSLM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|