C16H18N2O2 — CID 125028655
(NZ)-N-[(2R,3R,6R,7S,9Z,10R,11R,14S,16R)-9-hydroxyimino-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enylidene]hydroxylamine (PubChem CID 125028655) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (NZ)-N-[(2R,3R,6R,7S,9Z,10R,11R,14S,16R)-9-hydroxyimino-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2R,3R,6R,7S,9Z,10R,11R,14S,16R)-9-hydroxyimino-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 125028655 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (NZ)-N-[(2R,3R,6R,7S,9Z,10R,11R,14S,16R)-9-hydroxyimino-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enylidene]hydroxylamine |
| SMILES | O/N=C1/C[C@H]2[C@H]3C/C(=N/O)[C@H]4[C@H]3C3C5[C@@H](C=C[C@@H]54)[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C16H18N2O2/c19-17-9-3-7-8-4-10(18-20)13-6-2-1-5-11(6)16(15(8)13)14(7)12(5)9/h1-2,5-8,11-16,19-20H,3-4H2/b17-9-,18-10-/t5-,6+,7+,8-,11?,12-,13-,14-,15-,16?/m0/s1 |
| InChIKey | OVLMSHCCXMWFEX-MVRQCHLGSA-N |
| XLogP | 2.23 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|