C10H11NO — CID 119078569
(NZ)-N-[(1R,2S,7S,10R)-9-tricyclo[5.3.0.02,10]deca-3,5-dienylidene]hydroxylamine (PubChem CID 119078569) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is (NZ)-N-[(1R,2S,7S,10R)-9-tricyclo[5.3.0.02,10]deca-3,5-dienylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1R,2S,7S,10R)-9-tricyclo[5.3.0.02,10]deca-3,5-dienylidene]hydroxylamine |
|---|---|
| PubChem CID | 119078569 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (NZ)-N-[(1R,2S,7S,10R)-9-tricyclo[5.3.0.02,10]deca-3,5-dienylidene]hydroxylamine |
| SMILES | O/N=C1/C[C@H]2C=CC=C[C@@H]3[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C10H11NO/c12-11-8-5-6-3-1-2-4-7-9(6)10(7)8/h1-4,6-7,9-10,12H,5H2/b11-8-/t6-,7+,9-,10+/m1/s1 |
| InChIKey | UJVAVIPXGGHSMT-MAUHWPIPSA-N |
| XLogP | 1.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|