C10H11NO — CID 166475474
(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine (PubChem CID 166475474) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is (NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine.
| Compound Name | (NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine |
|---|---|
| PubChem CID | 166475474 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine |
| SMILES | O/N=C1\C=CC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C10H11NO/c12-11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-4,6-8,10,12H,5H2/b11-9+ |
| InChIKey | QUSWFFJVUFHQAC-PKNBQFBNSA-N |
| XLogP | 1.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|