C9H13NO — CID 98174711
(NE)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]ethylidene]hydroxylamine (PubChem CID 98174711) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (NE)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 98174711 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (NE)-N-[1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H13NO/c1-6(10-11)9-5-7-2-3-8(9)4-7/h2-3,7-9,11H,4-5H2,1H3/b10-6+/t7-,8+,9+/m1/s1 |
| InChIKey | BKMAIDRLVDHVHD-SYVKOAGUSA-N |
| XLogP | 2.05 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|