C11H14N2O2 — CID 124871184
(NE)-N-[(1S,2R,5R,6R,8S,9S,11Z)-11-hydroxyimino-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]hydroxylamine (PubChem CID 124871184) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (NE)-N-[(1S,2R,5R,6R,8S,9S,11Z)-11-hydroxyimino-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,2R,5R,6R,8S,9S,11Z)-11-hydroxyimino-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]hydroxylamine |
|---|---|
| PubChem CID | 124871184 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (NE)-N-[(1S,2R,5R,6R,8S,9S,11Z)-11-hydroxyimino-3-tetracyclo[6.3.0.02,6.05,9]undecanylidene]hydroxylamine |
| SMILES | O/N=C1/C[C@H]2[C@H]3C/C(=N\O)[C@@H]4[C@@H]3C[C@@H]2[C@H]14 |
| InChI | InChI=1S/C11H14N2O2/c14-12-8-2-4-5-3-9(13-15)11-7(5)1-6(4)10(8)11/h4-7,10-11,14-15H,1-3H2/b12-8-,13-9+/t4-,5+,6-,7+,10+,11-/m0/s1 |
| InChIKey | JWHDYBQMUQNNIA-ILUDYRPBSA-N |
| XLogP | 1.57 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|