C17H16O2 — CID 98557480
(1S,2R,3S,4R,5S,7R,9S,11S,12S,15S)-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione (PubChem CID 98557480) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S,7R,9S,11S,12S,15S)-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione.
| Compound Name | (1S,2R,3S,4R,5S,7R,9S,11S,12S,15S)-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione |
|---|---|
| PubChem CID | 98557480 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (1S,2R,3S,4R,5S,7R,9S,11S,12S,15S)-heptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione |
| SMILES | O=C1[C@@H]2[C@H]3C4C5[C@@H]2C=C[C@@H]5[C@@H]2C(=O)[C@@H]5C[C@H]1[C@@H]3[C@H]5[C@@H]42 |
| InChI | InChI=1S/C17H16O2/c18-16-6-3-7-10-9(6)14-11(16)4-1-2-5-8(4)13(14)15(10)12(5)17(7)19/h1-2,4-15H,3H2/t4-,5-,6-,7+,8?,9+,10-,11-,12-,13?,14-,15+/m0/s1 |
| InChIKey | FIIMZXNTXTZKRQ-MKAGNXCGSA-N |
| XLogP | 1.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|