C14H14O — CID 102239353
pentacyclo[7.5.0.02,8.03,12.05,11]tetradeca-6,13-dien-4-one (PubChem CID 102239353) has the molecular formula C14H14O and a molecular weight of 198.27 g/mol. Its IUPAC name is pentacyclo[7.5.0.02,8.03,12.05,11]tetradeca-6,13-dien-4-one.
| Compound Name | pentacyclo[7.5.0.02,8.03,12.05,11]tetradeca-6,13-dien-4-one |
|---|---|
| PubChem CID | 102239353 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | pentacyclo[7.5.0.02,8.03,12.05,11]tetradeca-6,13-dien-4-one |
| SMILES | O=C1C2C=CC3C4CC2C2C=CC4C3C12 |
| InChI | InChI=1S/C14H14O/c15-14-9-4-3-7-10-5-11(9)8-2-1-6(10)12(7)13(8)14/h1-4,6-13H,5H2 |
| InChIKey | DHCSYKRBIAPXGT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|