C11H14N2O2 — CID 134377457
(2S,6R,8R,10S)-4-amino-5-hydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-3-one (PubChem CID 134377457) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (2S,6R,8R,10S)-4-amino-5-hydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-3-one.
| Compound Name | (2S,6R,8R,10S)-4-amino-5-hydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-3-one |
|---|---|
| PubChem CID | 134377457 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (2S,6R,8R,10S)-4-amino-5-hydroxy-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-3-one |
| SMILES | NN1C(=O)[C@H]2C3C=CC([C@H]2C1O)[C@@H]1C[C@H]31 |
| InChI | InChI=1S/C11H14N2O2/c12-13-10(14)8-4-1-2-5(7-3-6(4)7)9(8)11(13)15/h1-2,4-10,14H,3,12H2/t4?,5?,6-,7+,8+,9-,10?/m0/s1 |
| InChIKey | RUOPZZLSKYXCHN-LYILPZOGSA-N |
| XLogP | -0.29 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|