C16H14Cl2N2O4 — CID 98476903
(1R,2R,3R,7R,8S,9S,10R,14R)-5,12-bis(chloromethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 98476903) has the molecular formula C16H14Cl2N2O4 and a molecular weight of 369.20 g/mol. Its IUPAC name is (1R,2R,3R,7R,8S,9S,10R,14R)-5,12-bis(chloromethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | (1R,2R,3R,7R,8S,9S,10R,14R)-5,12-bis(chloromethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 98476903 |
| Molecular Formula | C16H14Cl2N2O4 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | (1R,2R,3R,7R,8S,9S,10R,14R)-5,12-bis(chloromethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@H]2C(=O)N1CCl)[C@H]1[C@H]2C(=O)N(CCl)C(=O)[C@@H]2[C@@H]31 |
| InChI | InChI=1S/C16H14Cl2N2O4/c17-3-19-13(21)9-5-1-2-6(10(9)14(19)22)8-7(5)11-12(8)16(24)20(4-18)15(11)23/h1-2,5-12H,3-4H2/t5-,6+,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | YVCOWLFMOQPVIL-HGERKYINSA-N |
| XLogP | 0.64 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|