C16H18N2O12P2 — CID 98392372
[(1R,2R,3R,7R,8R,9R,10R,14R)-4,6,11,13-tetraoxo-5-(phosphonooxymethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl dihydrogen phosphate (PubChem CID 98392372) has the molecular formula C16H18N2O12P2 and a molecular weight of 492.27 g/mol. Its IUPAC name is [(1R,2R,3R,7R,8R,9R,10R,14R)-4,6,11,13-tetraoxo-5-(phosphonooxymethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl dihydrogen phosphate.
| Compound Name | [(1R,2R,3R,7R,8R,9R,10R,14R)-4,6,11,13-tetraoxo-5-(phosphonooxymethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 98392372 |
| Molecular Formula | C16H18N2O12P2 |
| Molecular Weight | 492.27 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | [(1R,2R,3R,7R,8R,9R,10R,14R)-4,6,11,13-tetraoxo-5-(phosphonooxymethyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl dihydrogen phosphate |
| SMILES | O=C1[C@@H]2[C@@H]3C=C[C@@H]([C@H]2C(=O)N1COP(=O)(O)O)[C@H]1[C@H]2C(=O)N(COP(=O)(O)O)C(=O)[C@@H]2[C@H]31 |
| InChI | InChI=1S/C16H18N2O12P2/c19-13-9-5-1-2-6(10(9)14(20)17(13)3-29-31(23,24)25)8-7(5)11-12(8)16(22)18(15(11)21)4-30-32(26,27)28/h1-2,5-12H,3-4H2,(H2,23,24,25)(H2,26,27,28)/t5-,6-,7-,8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | ASAZJSFNDYYGFI-KGQDQTHKSA-N |
| XLogP | -1.62 |
| TPSA | 208.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.27 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|