C26H18Br2N2O4 — CID 124784835
(1S,2S,3R,7S,8S,9R,10S,14R)-5,12-bis(4-bromophenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 124784835) has the molecular formula C26H18Br2N2O4 and a molecular weight of 582.25 g/mol. Its IUPAC name is (1S,2S,3R,7S,8S,9R,10S,14R)-5,12-bis(4-bromophenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | (1S,2S,3R,7S,8S,9R,10S,14R)-5,12-bis(4-bromophenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 124784835 |
| Molecular Formula | C26H18Br2N2O4 |
| Molecular Weight | 582.25 g/mol |
| Exact Mass | 579.96 |
| IUPAC Name | (1S,2S,3R,7S,8S,9R,10S,14R)-5,12-bis(4-bromophenyl)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]2C(=O)N1c1ccc(Br)cc1)[C@@H]1[C@@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@@H]2[C@@H]31 |
| InChI | InChI=1S/C26H18Br2N2O4/c27-11-1-5-13(6-2-11)29-23(31)19-15-9-10-16(20(19)24(29)32)18-17(15)21-22(18)26(34)30(25(21)33)14-7-3-12(28)4-8-14/h1-10,15-22H/t15-,16+,17-,18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | AQDMHFPEUBJVAL-MMPLWAHZSA-N |
| XLogP | 4.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|