C20H20BrNO2 — CID 11894501
(3aS,3bR,9aS,9bS)-2-(4-bromophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione (PubChem CID 11894501) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is (3aS,3bR,9aS,9bS)-2-(4-bromophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione.
| Compound Name | (3aS,3bR,9aS,9bS)-2-(4-bromophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 11894501 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (3aS,3bR,9aS,9bS)-2-(4-bromophenyl)-3a,3b,4,5,6,7,8,9,9a,9b-decahydro-as-indaceno[4,5-c]pyrrole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(Br)cc1)[C@H]1CCCC1=C1CCC[C@H]12 |
| InChI | InChI=1S/C20H20BrNO2/c21-11-7-9-12(10-8-11)22-19(23)17-15-5-1-3-13(15)14-4-2-6-16(14)18(17)20(22)24/h7-10,15-18H,1-6H2/t15-,16+,17-,18-/m0/s1 |
| InChIKey | AMMVIZFGDOYNHG-MHORFTMASA-N |
| XLogP | 4.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|