C29H24BrNO3 — CID 139260038
(4S,8aS)-2-(4-bromophenyl)-4-(2-naphthalen-1-yl-2-oxoethyl)-4,6,7,8,8a,8b-hexahydro-3aH-cyclopenta[e]isoindole-1,3-dione (PubChem CID 139260038) has the molecular formula C29H24BrNO3 and a molecular weight of 514.42 g/mol. Its IUPAC name is (4S,8aS)-2-(4-bromophenyl)-4-(2-naphthalen-1-yl-2-oxoethyl)-4,6,7,8,8a,8b-hexahydro-3aH-cyclopenta[e]isoindole-1,3-dione.
| Compound Name | (4S,8aS)-2-(4-bromophenyl)-4-(2-naphthalen-1-yl-2-oxoethyl)-4,6,7,8,8a,8b-hexahydro-3aH-cyclopenta[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139260038 |
| Molecular Formula | C29H24BrNO3 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | (4S,8aS)-2-(4-bromophenyl)-4-(2-naphthalen-1-yl-2-oxoethyl)-4,6,7,8,8a,8b-hexahydro-3aH-cyclopenta[e]isoindole-1,3-dione |
| SMILES | O=C(C[C@H]1C=C2CCC[C@H]2C2C(=O)N(c3ccc(Br)cc3)C(=O)C21)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H24BrNO3/c30-20-11-13-21(14-12-20)31-28(33)26-19(15-18-7-4-9-23(18)27(26)29(31)34)16-25(32)24-10-3-6-17-5-1-2-8-22(17)24/h1-3,5-6,8,10-15,19,23,26-27H,4,7,9,16H2/t19-,23-,26?,27?/m1/s1 |
| InChIKey | VQYAJYGSLZCUDR-CKJBZAQRSA-N |
| XLogP | 6.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|