C20H22N4O8 — CID 95906983
[(1R,2R,3R,7R,8S,9S,10R,14R)-5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate (PubChem CID 95906983) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is [(1R,2R,3R,7R,8S,9S,10R,14R)-5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate.
| Compound Name | [(1R,2R,3R,7R,8S,9S,10R,14R)-5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate |
|---|---|
| PubChem CID | 95906983 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | [(1R,2R,3R,7R,8S,9S,10R,14R)-5-[(2-aminoacetyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-aminoacetate |
| SMILES | NCC(=O)OCN1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@H]2C1=O)[C@H]1[C@H]2C(=O)N(COC(=O)CN)C(=O)[C@@H]2[C@@H]31 |
| InChI | InChI=1S/C20H22N4O8/c21-3-9(25)31-5-23-17(27)13-7-1-2-8(14(13)18(23)28)12-11(7)15-16(12)20(30)24(19(15)29)6-32-10(26)4-22/h1-2,7-8,11-16H,3-6,21-22H2/t7-,8+,11-,12+,13-,14-,15-,16-/m1/s1 |
| InChIKey | MERYGHQPWQNRHB-GYKCHUDGSA-N |
| XLogP | -2.83 |
| TPSA | 179.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|