C18H22O11 — CID 167687274
cyclohexane-1,2,4-tricarboxylic acid;1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid (PubChem CID 167687274) has the molecular formula C18H22O11 and a molecular weight of 414.36 g/mol. Its IUPAC name is cyclohexane-1,2,4-tricarboxylic acid;1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid.
| Compound Name | cyclohexane-1,2,4-tricarboxylic acid;1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 167687274 |
| Molecular Formula | C18H22O11 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | cyclohexane-1,2,4-tricarboxylic acid;1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)O)C(C(=O)O)C1.O=C(O)C1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C9H12O6.C9H10O5/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15);4-6H,1-3H2,(H,10,11) |
| InChIKey | WJYYOIWROVIEIJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|