C8H8O5 — CID 21293238
2,4-dioxo-3-oxabicyclo[3.2.1]octane-6-carboxylic acid (PubChem CID 21293238) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2,4-dioxo-3-oxabicyclo[3.2.1]octane-6-carboxylic acid.
| Compound Name | 2,4-dioxo-3-oxabicyclo[3.2.1]octane-6-carboxylic acid |
|---|---|
| PubChem CID | 21293238 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 2,4-dioxo-3-oxabicyclo[3.2.1]octane-6-carboxylic acid |
| SMILES | O=C1OC(=O)C2CC1CC2C(=O)O |
| InChI | InChI=1S/C8H8O5/c9-6(10)4-1-3-2-5(4)8(12)13-7(3)11/h3-5H,1-2H2,(H,9,10) |
| InChIKey | QGSUUHDVRIHQEX-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|