C12H14O5 — CID 87401609
prop-2-enyl 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate (PubChem CID 87401609) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is prop-2-enyl 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate.
| Compound Name | prop-2-enyl 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 87401609 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | prop-2-enyl 1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carboxylate |
| SMILES | C=CCOC(=O)C1CCC2C(=O)OC(=O)C2C1 |
| InChI | InChI=1S/C12H14O5/c1-2-5-16-10(13)7-3-4-8-9(6-7)12(15)17-11(8)14/h2,7-9H,1,3-6H2 |
| InChIKey | ZIWWUEIYTPJETJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|