C10H14O2 — CID 58140396
(10R)-10-methyl-5-oxatricyclo[5.2.1.03,8]decan-4-one (PubChem CID 58140396) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (10R)-10-methyl-5-oxatricyclo[5.2.1.03,8]decan-4-one.
| Compound Name | (10R)-10-methyl-5-oxatricyclo[5.2.1.03,8]decan-4-one |
|---|---|
| PubChem CID | 58140396 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (10R)-10-methyl-5-oxatricyclo[5.2.1.03,8]decan-4-one |
| SMILES | C[C@@H]1C2CC3C(=O)OCC1C3C2 |
| InChI | InChI=1S/C10H14O2/c1-5-6-2-7-8(3-6)10(11)12-4-9(5)7/h5-9H,2-4H2,1H3/t5-,6?,7?,8?,9?/m1/s1 |
| InChIKey | QZVVKEGYCSCZME-YJMOEEQWSA-N |
| XLogP | 1.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |