C18H36 — CID 158500744
1,3-ditert-butyl-2-methyl-5-propylcyclohexane (PubChem CID 158500744) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-methyl-5-propylcyclohexane.
| Compound Name | 1,3-ditert-butyl-2-methyl-5-propylcyclohexane |
|---|---|
| PubChem CID | 158500744 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 1,3-ditert-butyl-2-methyl-5-propylcyclohexane |
| SMILES | CCCC1CC(C(C)(C)C)C(C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C18H36/c1-9-10-14-11-15(17(3,4)5)13(2)16(12-14)18(6,7)8/h13-16H,9-12H2,1-8H3 |
| InChIKey | HJVYRIHEMAYBGH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |