C34H66O2 — CID 140706127
2,6-ditert-butyl-4-[6-(3,5-ditert-butyl-4-hydroxycyclohexyl)hexyl]cyclohexan-1-ol (PubChem CID 140706127) has the molecular formula C34H66O2 and a molecular weight of 506.90 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[6-(3,5-ditert-butyl-4-hydroxycyclohexyl)hexyl]cyclohexan-1-ol.
| Compound Name | 2,6-ditert-butyl-4-[6-(3,5-ditert-butyl-4-hydroxycyclohexyl)hexyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 140706127 |
| Molecular Formula | C34H66O2 |
| Molecular Weight | 506.90 g/mol |
| Exact Mass | 506.51 |
| IUPAC Name | 2,6-ditert-butyl-4-[6-(3,5-ditert-butyl-4-hydroxycyclohexyl)hexyl]cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CC(CCCCCCC2CC(C(C)(C)C)C(O)C(C(C)(C)C)C2)CC(C(C)(C)C)C1O |
| InChI | InChI=1S/C34H66O2/c1-31(2,3)25-19-23(20-26(29(25)35)32(4,5)6)17-15-13-14-16-18-24-21-27(33(7,8)9)30(36)28(22-24)34(10,11)12/h23-30,35-36H,13-22H2,1-12H3 |
| InChIKey | HOLJFORDQVPZDH-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.90 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|