C18H34O3 — CID 146207382
3-[3,5-ditert-butyl-4-(hydroxymethyl)cyclohexyl]propanoic acid (PubChem CID 146207382) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-[3,5-ditert-butyl-4-(hydroxymethyl)cyclohexyl]propanoic acid.
| Compound Name | 3-[3,5-ditert-butyl-4-(hydroxymethyl)cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 146207382 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 3-[3,5-ditert-butyl-4-(hydroxymethyl)cyclohexyl]propanoic acid |
| SMILES | CC(C)(C)C1CC(CCC(=O)O)CC(C(C)(C)C)C1CO |
| InChI | InChI=1S/C18H34O3/c1-17(2,3)14-9-12(7-8-16(20)21)10-15(13(14)11-19)18(4,5)6/h12-15,19H,7-11H2,1-6H3,(H,20,21) |
| InChIKey | KHHCWZXBXOUNST-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |