About 3-(thian-4-yl)propanoic acid
3-(thian-4-yl)propanoic acid (PubChem CID 82411342) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is 3-(thian-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(thian-4-yl)propanoic acid |
| PubChem CID | 82411342 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3-(thian-4-yl)propanoic acid |
| SMILES | O=C(O)CCC1CCSCC1 |
| InChI | InChI=1S/C8H14O2S/c9-8(10)2-1-7-3-5-11-6-4-7/h7H,1-6H2,(H,9,10) |
| InChIKey | PGSDPSLIQDDCNF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(thian-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thian-4-yl)propanoic acid?
The IUPAC name of 3-(thian-4-yl)propanoic acid (CID 82411342) is 3-(thian-4-yl)propanoic acid.
What is the SMILES notation for 3-(thian-4-yl)propanoic acid?
The canonical SMILES for 3-(thian-4-yl)propanoic acid is O=C(O)CCC1CCSCC1.
What is the InChIKey of 3-(thian-4-yl)propanoic acid?
The InChIKey is PGSDPSLIQDDCNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c9-8(10)2-1-7-3-5-11-6-4-7/h7H,1-6H2,(H,9,10).
What are the key properties of 3-(thian-4-yl)propanoic acid?
3-(thian-4-yl)propanoic acid has a molecular weight of 174.26 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thian-4-yl)propanoic acid is sourced from PubChem (CID 82411342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).