C14H24N2O3S — CID 62215737
3-[1-[methyl(thiolan-3-yl)carbamoyl]piperidin-4-yl]propanoic acid (PubChem CID 62215737) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is 3-[1-[methyl(thiolan-3-yl)carbamoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[methyl(thiolan-3-yl)carbamoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 62215737 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3-[1-[methyl(thiolan-3-yl)carbamoyl]piperidin-4-yl]propanoic acid |
| SMILES | CN(C(=O)N1CCC(CCC(=O)O)CC1)C1CCSC1 |
| InChI | InChI=1S/C14H24N2O3S/c1-15(12-6-9-20-10-12)14(19)16-7-4-11(5-8-16)2-3-13(17)18/h11-12H,2-10H2,1H3,(H,17,18) |
| InChIKey | IZFQERUWXKMOMN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |