C11H18N2O3S2 — CID 82904711
4-[methyl(thiolan-3-yl)carbamoyl]thiomorpholine-3-carboxylic acid (PubChem CID 82904711) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-[methyl(thiolan-3-yl)carbamoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[methyl(thiolan-3-yl)carbamoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82904711 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[methyl(thiolan-3-yl)carbamoyl]thiomorpholine-3-carboxylic acid |
| SMILES | CN(C(=O)N1CCSCC1C(=O)O)C1CCSC1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-12(8-2-4-17-6-8)11(16)13-3-5-18-7-9(13)10(14)15/h8-9H,2-7H2,1H3,(H,14,15) |
| InChIKey | JAZAKZVYKBUOBB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |