C11H20N2O3S2 — CID 114237830
4-[methyl(3-methylsulfanylpropyl)carbamoyl]thiomorpholine-3-carboxylic acid (PubChem CID 114237830) has the molecular formula C11H20N2O3S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-[methyl(3-methylsulfanylpropyl)carbamoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[methyl(3-methylsulfanylpropyl)carbamoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 114237830 |
| Molecular Formula | C11H20N2O3S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-[methyl(3-methylsulfanylpropyl)carbamoyl]thiomorpholine-3-carboxylic acid |
| SMILES | CSCCCN(C)C(=O)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C11H20N2O3S2/c1-12(4-3-6-17-2)11(16)13-5-7-18-8-9(13)10(14)15/h9H,3-8H2,1-2H3,(H,14,15) |
| InChIKey | QTZMHPBTEKOCNZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|