C12H18N4O3S — CID 82905115
4-[methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]thiomorpholine-3-carboxylic acid (PubChem CID 82905115) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-[methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82905115 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-[methyl-[(1-methylpyrazol-4-yl)methyl]carbamoyl]thiomorpholine-3-carboxylic acid |
| SMILES | CN(Cc1cnn(C)c1)C(=O)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C12H18N4O3S/c1-14(6-9-5-13-15(2)7-9)12(19)16-3-4-20-8-10(16)11(17)18/h5,7,10H,3-4,6,8H2,1-2H3,(H,17,18) |
| InChIKey | HSBAXACFEROCTE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |