C9H16N2O3S — CID 107297506
3-(thiolan-3-ylmethylcarbamoylamino)propanoic acid (PubChem CID 107297506) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 3-(thiolan-3-ylmethylcarbamoylamino)propanoic acid.
| Compound Name | 3-(thiolan-3-ylmethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 107297506 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-(thiolan-3-ylmethylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCC1CCSC1 |
| InChI | InChI=1S/C9H16N2O3S/c12-8(13)1-3-10-9(14)11-5-7-2-4-15-6-7/h7H,1-6H2,(H,12,13)(H2,10,11,14) |
| InChIKey | MRFYFYZKEDTYCJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |