C10H18N2O3S — CID 117235193
3-(thian-3-ylmethylcarbamoylamino)propanoic acid (PubChem CID 117235193) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-(thian-3-ylmethylcarbamoylamino)propanoic acid.
| Compound Name | 3-(thian-3-ylmethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 117235193 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-(thian-3-ylmethylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCC1CCCSC1 |
| InChI | InChI=1S/C10H18N2O3S/c13-9(14)3-4-11-10(15)12-6-8-2-1-5-16-7-8/h8H,1-7H2,(H,13,14)(H2,11,12,15) |
| InChIKey | NITUBCLHOKIRMI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |